C11H16N2O3S — CID 176986682
1-[(E)-1-amino-3-oxobut-1-en-2-yl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione (PubChem CID 176986682) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-[(E)-1-amino-3-oxobut-1-en-2-yl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[(E)-1-amino-3-oxobut-1-en-2-yl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176986682 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-[(E)-1-amino-3-oxobut-1-en-2-yl]-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
| SMILES | CC(=O)/C(=C\N)N1C(=O)CC(SC(C)C)C1=O |
| InChI | InChI=1S/C11H16N2O3S/c1-6(2)17-9-4-10(15)13(11(9)16)8(5-12)7(3)14/h5-6,9H,4,12H2,1-3H3/b8-5+ |
| InChIKey | BLYADVOOEDKDJK-VMPITWQZSA-N |
| XLogP | 0.64 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|