C8H13NO2S2 — CID 154954072
1-methylsulfanyl-3-propan-2-ylsulfanylpyrrolidine-2,5-dione (PubChem CID 154954072) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-methylsulfanyl-3-propan-2-ylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-methylsulfanyl-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 154954072 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 1-methylsulfanyl-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
| SMILES | CSN1C(=O)CC(SC(C)C)C1=O |
| InChI | InChI=1S/C8H13NO2S2/c1-5(2)13-6-4-7(10)9(12-3)8(6)11/h5-6H,4H2,1-3H3 |
| InChIKey | MSFJKJFKMHNRTE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|