C17H32N2O4S — CID 144786297
4-[(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)methyl]-N-hydroxycyclohexane-1-carboxamide;ethane;molecular hydrogen (PubChem CID 144786297) has the molecular formula C17H32N2O4S and a molecular weight of 360.52 g/mol. Its IUPAC name is 4-[(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)methyl]-N-hydroxycyclohexane-1-carboxamide;ethane;molecular hydrogen.
| Compound Name | 4-[(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)methyl]-N-hydroxycyclohexane-1-carboxamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144786297 |
| Molecular Formula | C17H32N2O4S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-[(2,5-dioxo-3-propan-2-ylsulfanylpyrrolidin-1-yl)methyl]-N-hydroxycyclohexane-1-carboxamide;ethane;molecular hydrogen |
| SMILES | CC.CC(C)SC1CC(=O)N(CC2CCC(C(=O)NO)CC2)C1=O.[H][H] |
| InChI | InChI=1S/C15H24N2O4S.C2H6.H2/c1-9(2)22-12-7-13(18)17(15(12)20)8-10-3-5-11(6-4-10)14(19)16-21;1-2;/h9-12,21H,3-8H2,1-2H3,(H,16,19);1-2H3;1H |
| InChIKey | QASHZHLUPGHVAT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|