C25H40N2O6S — CID 176791340
N-[2-(4-methyl-3-oxopentoxy)ethyl]-2-[1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide (PubChem CID 176791340) has the molecular formula C25H40N2O6S and a molecular weight of 496.67 g/mol. Its IUPAC name is N-[2-(4-methyl-3-oxopentoxy)ethyl]-2-[1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-[2-(4-methyl-3-oxopentoxy)ethyl]-2-[1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 176791340 |
| Molecular Formula | C25H40N2O6S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-[2-(4-methyl-3-oxopentoxy)ethyl]-2-[1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
| SMILES | CC(C)C(=O)CCOCCNC(=O)CSC1CC(=O)N(CC2CCC(C(=O)C(C)C)CC2)C1=O |
| InChI | InChI=1S/C25H40N2O6S/c1-16(2)20(28)9-11-33-12-10-26-22(29)15-34-21-13-23(30)27(25(21)32)14-18-5-7-19(8-6-18)24(31)17(3)4/h16-19,21H,5-15H2,1-4H3,(H,26,29) |
| InChIKey | BJPVXJFKWIGXIS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|