C16H25NO3 — CID 134510381
(3S)-3-methyl-1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pyrrolidine-2,5-dione (PubChem CID 134510381) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3S)-3-methyl-1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-methyl-1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134510381 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (3S)-3-methyl-1-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)C(=O)C1CCC(CN2C(=O)C[C@H](C)C2=O)CC1 |
| InChI | InChI=1S/C16H25NO3/c1-10(2)15(19)13-6-4-12(5-7-13)9-17-14(18)8-11(3)16(17)20/h10-13H,4-9H2,1-3H3/t11-,12?,13?/m0/s1 |
| InChIKey | WIUPWYLNBVGXGD-HIFPTAJRSA-N |
| XLogP | 2.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|