C18H31NO3 — CID 176680040
ethane;3-methyl-1-[4-(2-methylbutanoyl)cyclohexyl]pyrrolidine-2,5-dione (PubChem CID 176680040) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is ethane;3-methyl-1-[4-(2-methylbutanoyl)cyclohexyl]pyrrolidine-2,5-dione.
| Compound Name | ethane;3-methyl-1-[4-(2-methylbutanoyl)cyclohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176680040 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | ethane;3-methyl-1-[4-(2-methylbutanoyl)cyclohexyl]pyrrolidine-2,5-dione |
| SMILES | CC.CCC(C)C(=O)C1CCC(N2C(=O)CC(C)C2=O)CC1 |
| InChI | InChI=1S/C16H25NO3.C2H6/c1-4-10(2)15(19)12-5-7-13(8-6-12)17-14(18)9-11(3)16(17)20;1-2/h10-13H,4-9H2,1-3H3;1-2H3 |
| InChIKey | CXHLLYPBVKPERE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|