C18H33NO3 — CID 154687931
1-[(4-acetylcyclohexyl)methyl]-3-ethylpyrrolidine-2,5-dione;ethane;methane (PubChem CID 154687931) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[(4-acetylcyclohexyl)methyl]-3-ethylpyrrolidine-2,5-dione;ethane;methane.
| Compound Name | 1-[(4-acetylcyclohexyl)methyl]-3-ethylpyrrolidine-2,5-dione;ethane;methane |
|---|---|
| PubChem CID | 154687931 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 1-[(4-acetylcyclohexyl)methyl]-3-ethylpyrrolidine-2,5-dione;ethane;methane |
| SMILES | C.CC.CCC1CC(=O)N(CC2CCC(C(C)=O)CC2)C1=O |
| InChI | InChI=1S/C15H23NO3.C2H6.CH4/c1-3-12-8-14(18)16(15(12)19)9-11-4-6-13(7-5-11)10(2)17;1-2;/h11-13H,3-9H2,1-2H3;1-2H3;1H4 |
| InChIKey | QHWRQABKGXLGOQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|