C22H35NO5S — CID 160815612
methyl (2S)-2-[3-[1-[(4-but-1-en-2-ylcyclohexyl)methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropoxy]propanoate (PubChem CID 160815612) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is methyl (2S)-2-[3-[1-[(4-but-1-en-2-ylcyclohexyl)methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropoxy]propanoate.
| Compound Name | methyl (2S)-2-[3-[1-[(4-but-1-en-2-ylcyclohexyl)methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropoxy]propanoate |
|---|---|
| PubChem CID | 160815612 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | methyl (2S)-2-[3-[1-[(4-but-1-en-2-ylcyclohexyl)methyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropoxy]propanoate |
| SMILES | C=C(CC)C1CCC(CN2C(=O)CC(SCCCO[C@@H](C)C(=O)OC)C2=O)CC1 |
| InChI | InChI=1S/C22H35NO5S/c1-5-15(2)18-9-7-17(8-10-18)14-23-20(24)13-19(21(23)25)29-12-6-11-28-16(3)22(26)27-4/h16-19H,2,5-14H2,1,3-4H3/t16-,17?,18?,19?/m0/s1 |
| InChIKey | SOFDGPNYKUMWLT-ZBZISHEGSA-N |
| XLogP | 3.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|