C23H42N3O5PS2 — CID 170585179
6-[[4-[[3-(5-aminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]methyl]cyclohexanecarbonyl]amino]hexoxy-sulfanylphosphinous acid (PubChem CID 170585179) has the molecular formula C23H42N3O5PS2 and a molecular weight of 535.71 g/mol. Its IUPAC name is 6-[[4-[[3-(5-aminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]methyl]cyclohexanecarbonyl]amino]hexoxy-sulfanylphosphinous acid.
| Compound Name | 6-[[4-[[3-(5-aminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]methyl]cyclohexanecarbonyl]amino]hexoxy-sulfanylphosphinous acid |
|---|---|
| PubChem CID | 170585179 |
| Molecular Formula | C23H42N3O5PS2 |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 6-[[4-[[3-(5-aminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]methyl]cyclohexanecarbonyl]amino]hexoxy-sulfanylphosphinous acid |
| SMILES | NCCCCCSC1CC(=O)N(CC2CCC(C(=O)NCCCCCCOP(O)S)CC2)C1=O |
| InChI | InChI=1S/C23H42N3O5PS2/c24-12-4-3-7-15-34-20-16-21(27)26(23(20)29)17-18-8-10-19(11-9-18)22(28)25-13-5-1-2-6-14-31-32(30)33/h18-20,30,33H,1-17,24H2,(H,25,28) |
| InChIKey | VRMWXYXCQKMOTK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|