C28H46N2O9S — CID 146730664
[2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 5-[2-[2,5-dioxo-1-[(4-propanoylcyclohexyl)methyl]pyrrolidin-3-yl]sulfanylethylamino]-5-oxopentanoate (PubChem CID 146730664) has the molecular formula C28H46N2O9S and a molecular weight of 586.75 g/mol. Its IUPAC name is [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 5-[2-[2,5-dioxo-1-[(4-propanoylcyclohexyl)methyl]pyrrolidin-3-yl]sulfanylethylamino]-5-oxopentanoate.
| Compound Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 5-[2-[2,5-dioxo-1-[(4-propanoylcyclohexyl)methyl]pyrrolidin-3-yl]sulfanylethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 146730664 |
| Molecular Formula | C28H46N2O9S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 5-[2-[2,5-dioxo-1-[(4-propanoylcyclohexyl)methyl]pyrrolidin-3-yl]sulfanylethylamino]-5-oxopentanoate |
| SMILES | CCC(=O)C1CCC(CN2C(=O)CC(SCCNC(=O)CCCC(=O)OCC(OC)OC(CC)CO)C2=O)CC1 |
| InChI | InChI=1S/C28H46N2O9S/c1-4-21(17-31)39-27(37-3)18-38-26(35)8-6-7-24(33)29-13-14-40-23-15-25(34)30(28(23)36)16-19-9-11-20(12-10-19)22(32)5-2/h19-21,23,27,31H,4-18H2,1-3H3,(H,29,33) |
| InChIKey | RHLJDTSARFVEFJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|