C18H30N2O8S — CID 118680761
2-(2-hydroxy-1-methoxyethoxy)butyl 5-[2-(2,5-dioxopyrrolidin-3-yl)sulfanylethylamino]-5-oxopentanoate (PubChem CID 118680761) has the molecular formula C18H30N2O8S and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-(2-hydroxy-1-methoxyethoxy)butyl 5-[2-(2,5-dioxopyrrolidin-3-yl)sulfanylethylamino]-5-oxopentanoate.
| Compound Name | 2-(2-hydroxy-1-methoxyethoxy)butyl 5-[2-(2,5-dioxopyrrolidin-3-yl)sulfanylethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 118680761 |
| Molecular Formula | C18H30N2O8S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-(2-hydroxy-1-methoxyethoxy)butyl 5-[2-(2,5-dioxopyrrolidin-3-yl)sulfanylethylamino]-5-oxopentanoate |
| SMILES | CCC(COC(=O)CCCC(=O)NCCSC1CC(=O)NC1=O)OC(CO)OC |
| InChI | InChI=1S/C18H30N2O8S/c1-3-12(28-17(10-21)26-2)11-27-16(24)6-4-5-14(22)19-7-8-29-13-9-15(23)20-18(13)25/h12-13,17,21H,3-11H2,1-2H3,(H,19,22)(H,20,23,25) |
| InChIKey | CENLMSUCNJKPFF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|