C19H37NO6S2 — CID 89303663
[2-[(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]oxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 5-[2-(disulfanyl)ethylamino]-5-oxopentanoate (PubChem CID 89303663) has the molecular formula C19H37NO6S2 and a molecular weight of 439.64 g/mol. Its IUPAC name is [2-[(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]oxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 5-[2-(disulfanyl)ethylamino]-5-oxopentanoate.
| Compound Name | [2-[(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]oxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 5-[2-(disulfanyl)ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 89303663 |
| Molecular Formula | C19H37NO6S2 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [2-[(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]oxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 5-[2-(disulfanyl)ethylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(COC(=O)CCCC(=O)NCCSS)O[C@@H](CO)C(C)(C)C |
| InChI | InChI=1S/C19H37NO6S2/c1-18(2,3)14(12-21)25-17(26-19(4,5)6)13-24-16(23)9-7-8-15(22)20-10-11-28-27/h14,17,21,27H,7-13H2,1-6H3,(H,20,22)/t14-,17?/m0/s1 |
| InChIKey | UJWIZDUXTAYVSM-MBIQTGHCSA-N |
| XLogP | 2.96 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|