C20H37BrN2O7 — CID 122451535
(2-methoxy-2-pentan-3-yloxyethyl) 4-[3-[3-[(2-bromoacetyl)amino]propoxy]propylamino]-4-oxobutanoate (PubChem CID 122451535) has the molecular formula C20H37BrN2O7 and a molecular weight of 497.43 g/mol. Its IUPAC name is (2-methoxy-2-pentan-3-yloxyethyl) 4-[3-[3-[(2-bromoacetyl)amino]propoxy]propylamino]-4-oxobutanoate.
| Compound Name | (2-methoxy-2-pentan-3-yloxyethyl) 4-[3-[3-[(2-bromoacetyl)amino]propoxy]propylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 122451535 |
| Molecular Formula | C20H37BrN2O7 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (2-methoxy-2-pentan-3-yloxyethyl) 4-[3-[3-[(2-bromoacetyl)amino]propoxy]propylamino]-4-oxobutanoate |
| SMILES | CCC(CC)OC(COC(=O)CCC(=O)NCCCOCCCNC(=O)CBr)OC |
| InChI | InChI=1S/C20H37BrN2O7/c1-4-16(5-2)30-20(27-3)15-29-19(26)9-8-17(24)22-10-6-12-28-13-7-11-23-18(25)14-21/h16,20H,4-15H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | BUOQDTDAQMPWBO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|