C15H27NO7 — CID 58035456
[2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-(2-methoxyprop-2-enylamino)-4-oxobutanoate (PubChem CID 58035456) has the molecular formula C15H27NO7 and a molecular weight of 333.38 g/mol. Its IUPAC name is [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-(2-methoxyprop-2-enylamino)-4-oxobutanoate.
| Compound Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-(2-methoxyprop-2-enylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 58035456 |
| Molecular Formula | C15H27NO7 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-(2-methoxyprop-2-enylamino)-4-oxobutanoate |
| SMILES | C=C(CNC(=O)CCC(=O)OCC(OC)OC(CC)CO)OC |
| InChI | InChI=1S/C15H27NO7/c1-5-12(9-17)23-15(21-4)10-22-14(19)7-6-13(18)16-8-11(2)20-3/h12,15,17H,2,5-10H2,1,3-4H3,(H,16,18) |
| InChIKey | XPSBSNSOXFKEMY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|