C15H28O6 — CID 126663469
[2-(1-hydroxybutan-2-yloxy)-2-propan-2-yloxyethyl] 5-oxohexanoate (PubChem CID 126663469) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is [2-(1-hydroxybutan-2-yloxy)-2-propan-2-yloxyethyl] 5-oxohexanoate.
| Compound Name | [2-(1-hydroxybutan-2-yloxy)-2-propan-2-yloxyethyl] 5-oxohexanoate |
|---|---|
| PubChem CID | 126663469 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [2-(1-hydroxybutan-2-yloxy)-2-propan-2-yloxyethyl] 5-oxohexanoate |
| SMILES | CCC(CO)OC(COC(=O)CCCC(C)=O)OC(C)C |
| InChI | InChI=1S/C15H28O6/c1-5-13(9-16)21-15(20-11(2)3)10-19-14(18)8-6-7-12(4)17/h11,13,15-16H,5-10H2,1-4H3 |
| InChIKey | MCEKYBWYWFEBMT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|