C16H30O5 — CID 118014263
2-deuterio-7-[2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-2-methyloct-7-en-3-one (PubChem CID 118014263) has the molecular formula C16H30O5 and a molecular weight of 303.42 g/mol. Its IUPAC name is 2-deuterio-7-[2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-2-methyloct-7-en-3-one.
| Compound Name | 2-deuterio-7-[2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-2-methyloct-7-en-3-one |
|---|---|
| PubChem CID | 118014263 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-deuterio-7-[2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-2-methyloct-7-en-3-one |
| SMILES | [2H]C(C)(C)C(=O)CCCC(=C)OCC(OC)OC(CC)CO |
| InChI | InChI=1S/C16H30O5/c1-6-14(10-17)21-16(19-5)11-20-13(4)8-7-9-15(18)12(2)3/h12,14,16-17H,4,6-11H2,1-3,5H3/i12D |
| InChIKey | FKGBOWGCKMBFGT-UQBWLURTSA-N |
| XLogP | 2.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|