C15H28NO7P — CID 58176005
[2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-oxo-4-[2-(tritiophosphanylmethoxy)prop-2-enylamino]butanoate (PubChem CID 58176005) has the molecular formula C15H28NO7P and a molecular weight of 367.37 g/mol. Its IUPAC name is [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-oxo-4-[2-(tritiophosphanylmethoxy)prop-2-enylamino]butanoate.
| Compound Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-oxo-4-[2-(tritiophosphanylmethoxy)prop-2-enylamino]butanoate |
|---|---|
| PubChem CID | 58176005 |
| Molecular Formula | C15H28NO7P |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] 4-oxo-4-[2-(tritiophosphanylmethoxy)prop-2-enylamino]butanoate |
| SMILES | [3H]PCOC(=C)CNC(=O)CCC(=O)OCC(OC)OC(CC)CO |
| InChI | InChI=1S/C15H28NO7P/c1-4-12(8-17)23-15(20-3)9-21-14(19)6-5-13(18)16-7-11(2)22-10-24/h12,15,17H,2,4-10,24H2,1,3H3,(H,16,18)/i24T |
| InChIKey | QVVMDJKOGORKTD-WSJDRZBNSA-N |
| XLogP | 0.55 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|