C19H38N2O6 — CID 59185260
4-[3-[[2-(2,3-dimethoxypropoxy)acetyl]amino]propoxy]-N-pentylbutanamide (PubChem CID 59185260) has the molecular formula C19H38N2O6 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-[3-[[2-(2,3-dimethoxypropoxy)acetyl]amino]propoxy]-N-pentylbutanamide.
| Compound Name | 4-[3-[[2-(2,3-dimethoxypropoxy)acetyl]amino]propoxy]-N-pentylbutanamide |
|---|---|
| PubChem CID | 59185260 |
| Molecular Formula | C19H38N2O6 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 4-[3-[[2-(2,3-dimethoxypropoxy)acetyl]amino]propoxy]-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)CCCOCCCNC(=O)COCC(COC)OC |
| InChI | InChI=1S/C19H38N2O6/c1-4-5-6-10-20-18(22)9-7-12-26-13-8-11-21-19(23)16-27-15-17(25-3)14-24-2/h17H,4-16H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | MZJXEIKJMCHBSX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|