C29H50N4O6S2 — CID 145348707
6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-[6-(2,5-dioxopyrrolidin-3-yl)sulfanylhexanoylamino]heptyl]hexanamide;ethane (PubChem CID 145348707) has the molecular formula C29H50N4O6S2 and a molecular weight of 614.88 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-[6-(2,5-dioxopyrrolidin-3-yl)sulfanylhexanoylamino]heptyl]hexanamide;ethane.
| Compound Name | 6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-[6-(2,5-dioxopyrrolidin-3-yl)sulfanylhexanoylamino]heptyl]hexanamide;ethane |
|---|---|
| PubChem CID | 145348707 |
| Molecular Formula | C29H50N4O6S2 |
| Molecular Weight | 614.88 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | 6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-[6-(2,5-dioxopyrrolidin-3-yl)sulfanylhexanoylamino]heptyl]hexanamide;ethane |
| SMILES | CC.CCC(CCCCNC(=O)CCCCCSC1CC(=O)NC1=O)NC(=O)CCCCCSC1CC(=O)NC1=O |
| InChI | InChI=1S/C27H44N4O6S2.C2H6/c1-2-19(29-23(33)13-6-4-10-16-39-21-18-25(35)31-27(21)37)11-7-8-14-28-22(32)12-5-3-9-15-38-20-17-24(34)30-26(20)36;1-2/h19-21H,2-18H2,1H3,(H,28,32)(H,29,33)(H,30,34,36)(H,31,35,37);1-2H3 |
| InChIKey | OUYVQPZKSFUDAK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|