C31H53N3O6S2 — CID 159284642
ethane;6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-methyl-12-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-7-oxododecyl]hexanamide (PubChem CID 159284642) has the molecular formula C31H53N3O6S2 and a molecular weight of 627.91 g/mol. Its IUPAC name is ethane;6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-methyl-12-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-7-oxododecyl]hexanamide.
| Compound Name | ethane;6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-methyl-12-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-7-oxododecyl]hexanamide |
|---|---|
| PubChem CID | 159284642 |
| Molecular Formula | C31H53N3O6S2 |
| Molecular Weight | 627.91 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | ethane;6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-N-[5-methyl-12-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-7-oxododecyl]hexanamide |
| SMILES | CC.CC(CCCCNC(=O)CCCCCSC1CC(=O)N(C)C1=O)CC(=O)CCCCCSC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C29H47N3O6S2.C2H6/c1-21(18-22(33)13-6-4-10-16-39-23-19-26(35)31(2)28(23)37)12-8-9-15-30-25(34)14-7-5-11-17-40-24-20-27(36)32(3)29(24)38;1-2/h21,23-24H,4-20H2,1-3H3,(H,30,34);1-2H3 |
| InChIKey | KZIWWLNNHDMMDU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|