C22H36N4O5S — CID 58165973
2-[4-[(6R)-6-methyl-4,7-dioxooctyl]piperazin-1-yl]-N-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]acetamide (PubChem CID 58165973) has the molecular formula C22H36N4O5S and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-[4-[(6R)-6-methyl-4,7-dioxooctyl]piperazin-1-yl]-N-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]acetamide.
| Compound Name | 2-[4-[(6R)-6-methyl-4,7-dioxooctyl]piperazin-1-yl]-N-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 58165973 |
| Molecular Formula | C22H36N4O5S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 2-[4-[(6R)-6-methyl-4,7-dioxooctyl]piperazin-1-yl]-N-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]acetamide |
| SMILES | CC(=O)[C@H](C)CC(=O)CCCN1CCN(CC(=O)NCCSC2CC(=O)N(C)C2=O)CC1 |
| InChI | InChI=1S/C22H36N4O5S/c1-16(17(2)27)13-18(28)5-4-7-25-8-10-26(11-9-25)15-20(29)23-6-12-32-19-14-21(30)24(3)22(19)31/h16,19H,4-15H2,1-3H3,(H,23,29)/t16-,19?/m1/s1 |
| InChIKey | YXGQPSYXRVVTMG-VTBWFHPJSA-N |
| XLogP | 0.18 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|