C20H33N3O5S — CID 162257671
N-[2-(methylamino)ethyl]-9-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-oxo-2-(2-oxopropyl)nonanamide (PubChem CID 162257671) has the molecular formula C20H33N3O5S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-9-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-oxo-2-(2-oxopropyl)nonanamide.
| Compound Name | N-[2-(methylamino)ethyl]-9-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-oxo-2-(2-oxopropyl)nonanamide |
|---|---|
| PubChem CID | 162257671 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[2-(methylamino)ethyl]-9-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-oxo-2-(2-oxopropyl)nonanamide |
| SMILES | CNCCNC(=O)C(CC(C)=O)CC(=O)CCCCCSC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C20H33N3O5S/c1-14(24)11-15(19(27)22-9-8-21-2)12-16(25)7-5-4-6-10-29-17-13-18(26)23(3)20(17)28/h15,17,21H,4-13H2,1-3H3,(H,22,27) |
| InChIKey | OBZARIUNOVAXIV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|