C17H30IN5O4S — CID 88973703
2-[2-[6-(1-iodo-2,5-dioxopyrrolidin-3-yl)sulfanylhexylamino]ethylcarbamoylamino]-2-methylpropanamide (PubChem CID 88973703) has the molecular formula C17H30IN5O4S and a molecular weight of 527.43 g/mol. Its IUPAC name is 2-[2-[6-(1-iodo-2,5-dioxopyrrolidin-3-yl)sulfanylhexylamino]ethylcarbamoylamino]-2-methylpropanamide.
| Compound Name | 2-[2-[6-(1-iodo-2,5-dioxopyrrolidin-3-yl)sulfanylhexylamino]ethylcarbamoylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 88973703 |
| Molecular Formula | C17H30IN5O4S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 2-[2-[6-(1-iodo-2,5-dioxopyrrolidin-3-yl)sulfanylhexylamino]ethylcarbamoylamino]-2-methylpropanamide |
| SMILES | CC(C)(NC(=O)NCCNCCCCCCSC1CC(=O)N(I)C1=O)C(N)=O |
| InChI | InChI=1S/C17H30IN5O4S/c1-17(2,15(19)26)22-16(27)21-9-8-20-7-5-3-4-6-10-28-12-11-13(24)23(18)14(12)25/h12,20H,3-11H2,1-2H3,(H2,19,26)(H2,21,22,27) |
| InChIKey | DWYLHOLVCFGVMB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|