C23H40N2O4S — CID 134331982
N-[6-[1-[(4S)-4,5-dimethyl-3-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl]-2,2-dimethylpropanamide (PubChem CID 134331982) has the molecular formula C23H40N2O4S and a molecular weight of 440.65 g/mol. Its IUPAC name is N-[6-[1-[(4S)-4,5-dimethyl-3-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl]-2,2-dimethylpropanamide.
| Compound Name | N-[6-[1-[(4S)-4,5-dimethyl-3-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134331982 |
| Molecular Formula | C23H40N2O4S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | N-[6-[1-[(4S)-4,5-dimethyl-3-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylhexyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)[C@H](C)C(=O)CCN1C(=O)CC(SCCCCCCNC(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C23H40N2O4S/c1-16(2)17(3)18(26)11-13-25-20(27)15-19(21(25)28)30-14-10-8-7-9-12-24-22(29)23(4,5)6/h16-17,19H,7-15H2,1-6H3,(H,24,29)/t17-,19?/m0/s1 |
| InChIKey | SEJLHGVBTCIETQ-KKFHFHRHSA-N |
| XLogP | 3.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|