C15H20N4O6S2 — CID 154664302
(2,5-dioxopyrrolidin-1-yl) 3-[3-[2-(methylcarbamothioylamino)ethylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoate (PubChem CID 154664302) has the molecular formula C15H20N4O6S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-[2-(methylcarbamothioylamino)ethylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[2-(methylcarbamothioylamino)ethylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 154664302 |
| Molecular Formula | C15H20N4O6S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[2-(methylcarbamothioylamino)ethylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoate |
| SMILES | CNC(=S)NCCSC1CC(=O)N(CCC(=O)ON2C(=O)CCC2=O)C1=O |
| InChI | InChI=1S/C15H20N4O6S2/c1-16-15(26)17-5-7-27-9-8-12(22)18(14(9)24)6-4-13(23)25-19-10(20)2-3-11(19)21/h9H,2-8H2,1H3,(H2,16,17,26) |
| InChIKey | LQNFEAKDOCESLB-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|