C20H28N4O8S — CID 121459701
(2,5-dioxopyrrolidin-1-yl) 6-[3-[2-[(2-aminoacetyl)amino]-3-oxobutyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoate (PubChem CID 121459701) has the molecular formula C20H28N4O8S and a molecular weight of 484.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[3-[2-[(2-aminoacetyl)amino]-3-oxobutyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[2-[(2-aminoacetyl)amino]-3-oxobutyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 121459701 |
| Molecular Formula | C20H28N4O8S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[2-[(2-aminoacetyl)amino]-3-oxobutyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoate |
| SMILES | CC(=O)C(CSC1CC(=O)N(CCCCCC(=O)ON2C(=O)CCC2=O)C1=O)NC(=O)CN |
| InChI | InChI=1S/C20H28N4O8S/c1-12(25)13(22-15(26)10-21)11-33-14-9-18(29)23(20(14)31)8-4-2-3-5-19(30)32-24-16(27)6-7-17(24)28/h13-14H,2-11,21H2,1H3,(H,22,26) |
| InChIKey | ZIURIFPQOPDZHP-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 173.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|