C19H30N4O6S — CID 144975415
(2R)-2-acetamido-3-[2,5-dioxo-1-(6-oxo-6-piperazin-1-ylhexyl)pyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 144975415) has the molecular formula C19H30N4O6S and a molecular weight of 442.54 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2,5-dioxo-1-(6-oxo-6-piperazin-1-ylhexyl)pyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2,5-dioxo-1-(6-oxo-6-piperazin-1-ylhexyl)pyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 144975415 |
| Molecular Formula | C19H30N4O6S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2R)-2-acetamido-3-[2,5-dioxo-1-(6-oxo-6-piperazin-1-ylhexyl)pyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC1CC(=O)N(CCCCCC(=O)N2CCNCC2)C1=O)C(=O)O |
| InChI | InChI=1S/C19H30N4O6S/c1-13(24)21-14(19(28)29)12-30-15-11-17(26)23(18(15)27)8-4-2-3-5-16(25)22-9-6-20-7-10-22/h14-15,20H,2-12H2,1H3,(H,21,24)(H,28,29)/t14-,15?/m0/s1 |
| InChIKey | LRGZVQYAFCUJFN-MLCCFXAWSA-N |
| XLogP | -0.57 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|