C28H34N4O5S — CID 146387487
6-[3-[(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-phenylhexanamide (PubChem CID 146387487) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is 6-[3-[(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-phenylhexanamide.
| Compound Name | 6-[3-[(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-phenylhexanamide |
|---|---|
| PubChem CID | 146387487 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 6-[3-[(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-phenylhexanamide |
| SMILES | CC(=O)N[C@@H](CSC1CC(=O)N(CCCCCC(=O)Nc2ccccc2)C1=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H34N4O5S/c1-20(33)30-23(27(36)29-18-21-11-5-2-6-12-21)19-38-24-17-26(35)32(28(24)37)16-10-4-9-15-25(34)31-22-13-7-3-8-14-22/h2-3,5-8,11-14,23-24H,4,9-10,15-19H2,1H3,(H,29,36)(H,30,33)(H,31,34)/t23-,24?/m0/s1 |
| InChIKey | PZPYUZAXILHZOR-UXMRNZNESA-N |
| XLogP | 2.87 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|