C32H37N3O5PS+ — CID 138522047
5-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]pentyl-triphenylphosphanium (PubChem CID 138522047) has the molecular formula C32H37N3O5PS+ and a molecular weight of 606.71 g/mol. Its IUPAC name is 5-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]pentyl-triphenylphosphanium.
| Compound Name | 5-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]pentyl-triphenylphosphanium |
|---|---|
| PubChem CID | 138522047 |
| Molecular Formula | C32H37N3O5PS+ |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | 5-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]pentyl-triphenylphosphanium |
| SMILES | N[C@@H](CSC1CC(=O)N(CCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C32H36N3O5PS/c33-27(31(39)34-22-30(37)38)23-42-28-21-29(36)35(32(28)40)19-11-4-12-20-41(24-13-5-1-6-14-24,25-15-7-2-8-16-25)26-17-9-3-10-18-26/h1-3,5-10,13-18,27-28H,4,11-12,19-23,33H2,(H-,34,37,38,39)/p+1/t27-,28?/m0/s1 |
| InChIKey | CPPABQHPTASEGC-MBMZGMDYSA-O |
| XLogP | 2.54 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|