C31H35BrN3O5PS — CID 138521971
4-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium bromide (PubChem CID 138521971) has the molecular formula C31H35BrN3O5PS and a molecular weight of 672.58 g/mol. Its IUPAC name is 4-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium bromide.
| Compound Name | 4-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 138521971 |
| Molecular Formula | C31H35BrN3O5PS |
| Molecular Weight | 672.58 g/mol |
| Exact Mass | 671.12 |
| IUPAC Name | 4-[3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium bromide |
| SMILES | N[C@@H](CSC1CC(=O)N(CCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1=O)C(=O)NCC(=O)O.[Br-] |
| InChI | InChI=1S/C31H34N3O5PS.BrH/c32-26(30(38)33-21-29(36)37)22-41-27-20-28(35)34(31(27)39)18-10-11-19-40(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25;/h1-9,12-17,26-27H,10-11,18-22,32H2,(H-,33,36,37,38);1H/t26-,27?;/m0./s1 |
| InChIKey | QPMWFDVZKIZQKQ-DDXKXVGSSA-N |
| XLogP | -0.85 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.58 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|