C27H28BrN2O4PS — CID 138521797
2-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]ethyl-triphenylphosphanium bromide (PubChem CID 138521797) has the molecular formula C27H28BrN2O4PS and a molecular weight of 587.48 g/mol. Its IUPAC name is 2-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]ethyl-triphenylphosphanium bromide.
| Compound Name | 2-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]ethyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 138521797 |
| Molecular Formula | C27H28BrN2O4PS |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 2-[3-(2-amino-2-carboxyethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]ethyl-triphenylphosphanium bromide |
| SMILES | NC(CSC1CC(=O)N(CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1=O)C(=O)O.[Br-] |
| InChI | InChI=1S/C27H27N2O4PS.BrH/c28-23(27(32)33)19-35-24-18-25(30)29(26(24)31)16-17-34(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22;/h1-15,23-24H,16-19,28H2;1H |
| InChIKey | KJVMFUWRWOIBBX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|