C29H32N2O4PS+ — CID 138521860
4-[3-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium (PubChem CID 138521860) has the molecular formula C29H32N2O4PS+ and a molecular weight of 535.63 g/mol. Its IUPAC name is 4-[3-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium.
| Compound Name | 4-[3-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 138521860 |
| Molecular Formula | C29H32N2O4PS+ |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-[3-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]butyl-triphenylphosphanium |
| SMILES | N[C@@H](CSC1CC(=O)N(CCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1=O)C(=O)O |
| InChI | InChI=1S/C29H31N2O4PS/c30-25(29(34)35)21-37-26-20-27(32)31(28(26)33)18-10-11-19-36(22-12-4-1-5-13-22,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-9,12-17,25-26H,10-11,18-21,30H2/p+1/t25-,26?/m0/s1 |
| InChIKey | FCOJZBKDTDJUHG-PMCHYTPCSA-O |
| XLogP | 3.03 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|