C29H31BrN3O5PS — CID 169080531
2-[[2-amino-3-[1-[2-[bromo(triphenyl)-λ5-phosphanyl]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoyl]amino]acetic acid (PubChem CID 169080531) has the molecular formula C29H31BrN3O5PS and a molecular weight of 644.53 g/mol. Its IUPAC name is 2-[[2-amino-3-[1-[2-[bromo(triphenyl)-λ5-phosphanyl]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-amino-3-[1-[2-[bromo(triphenyl)-λ5-phosphanyl]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 169080531 |
| Molecular Formula | C29H31BrN3O5PS |
| Molecular Weight | 644.53 g/mol |
| Exact Mass | 643.09 |
| IUPAC Name | 2-[[2-amino-3-[1-[2-[bromo(triphenyl)-λ5-phosphanyl]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoyl]amino]acetic acid |
| SMILES | NC(CSC1CC(=O)N(CCP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)C1=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C29H31BrN3O5PS/c30-39(21-10-4-1-5-11-21,22-12-6-2-7-13-22,23-14-8-3-9-15-23)17-16-33-26(34)18-25(29(33)38)40-20-24(31)28(37)32-19-27(35)36/h1-15,24-25H,16-20,31H2,(H,32,37)(H,35,36) |
| InChIKey | ZBKVKUKREZWGGO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|