C30H37BrN3O4PS2 — CID 169080431
2-[[2-amino-3-[[2-[5-[bromo(triphenyl)-λ5-phosphanyl]pentylamino]-2-oxoethyl]disulfanyl]propanoyl]amino]acetic acid (PubChem CID 169080431) has the molecular formula C30H37BrN3O4PS2 and a molecular weight of 678.65 g/mol. Its IUPAC name is 2-[[2-amino-3-[[2-[5-[bromo(triphenyl)-λ5-phosphanyl]pentylamino]-2-oxoethyl]disulfanyl]propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-amino-3-[[2-[5-[bromo(triphenyl)-λ5-phosphanyl]pentylamino]-2-oxoethyl]disulfanyl]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 169080431 |
| Molecular Formula | C30H37BrN3O4PS2 |
| Molecular Weight | 678.65 g/mol |
| Exact Mass | 677.11 |
| IUPAC Name | 2-[[2-amino-3-[[2-[5-[bromo(triphenyl)-λ5-phosphanyl]pentylamino]-2-oxoethyl]disulfanyl]propanoyl]amino]acetic acid |
| SMILES | NC(CSSCC(=O)NCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C30H37BrN3O4PS2/c31-39(24-13-5-1-6-14-24,25-15-7-2-8-16-25,26-17-9-3-10-18-26)20-12-4-11-19-33-28(35)23-41-40-22-27(32)30(38)34-21-29(36)37/h1-3,5-10,13-18,27H,4,11-12,19-23,32H2,(H,33,35)(H,34,38)(H,36,37) |
| InChIKey | ZOAIESVGQWNDSY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|