C22H42N4O6S2 — CID 89495837
8-[[2-amino-3-[[2-amino-3-(7-carboxyheptylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]octanoic acid (PubChem CID 89495837) has the molecular formula C22H42N4O6S2 and a molecular weight of 522.73 g/mol. Its IUPAC name is 8-[[2-amino-3-[[2-amino-3-(7-carboxyheptylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]octanoic acid.
| Compound Name | 8-[[2-amino-3-[[2-amino-3-(7-carboxyheptylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]octanoic acid |
|---|---|
| PubChem CID | 89495837 |
| Molecular Formula | C22H42N4O6S2 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 8-[[2-amino-3-[[2-amino-3-(7-carboxyheptylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]octanoic acid |
| SMILES | NC(CSSCC(N)C(=O)NCCCCCCCC(=O)O)C(=O)NCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H42N4O6S2/c23-17(21(31)25-13-9-5-1-3-7-11-19(27)28)15-33-34-16-18(24)22(32)26-14-10-6-2-4-8-12-20(29)30/h17-18H,1-16,23-24H2,(H,25,31)(H,26,32)(H,27,28)(H,29,30) |
| InChIKey | YZBDRLVOYGXYFR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|