C7H15N3O3 — CID 123677811
4-(2,3-diaminopropanoylamino)butanoic acid (PubChem CID 123677811) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4-(2,3-diaminopropanoylamino)butanoic acid.
| Compound Name | 4-(2,3-diaminopropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 123677811 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 4-(2,3-diaminopropanoylamino)butanoic acid |
| SMILES | NCC(N)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C7H15N3O3/c8-4-5(9)7(13)10-3-1-2-6(11)12/h5H,1-4,8-9H2,(H,10,13)(H,11,12) |
| InChIKey | HZPSIPLBHAOYKZ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|