C12H24N2O3 — CID 107471722
4-[[2-(aminomethyl)-4,4-dimethylpentanoyl]amino]butanoic acid (PubChem CID 107471722) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-[[2-(aminomethyl)-4,4-dimethylpentanoyl]amino]butanoic acid.
| Compound Name | 4-[[2-(aminomethyl)-4,4-dimethylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107471722 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4-[[2-(aminomethyl)-4,4-dimethylpentanoyl]amino]butanoic acid |
| SMILES | CC(C)(C)CC(CN)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H24N2O3/c1-12(2,3)7-9(8-13)11(17)14-6-4-5-10(15)16/h9H,4-8,13H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | YNDUPRWKMYUUPB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|