C21H44N4O4 — CID 157218068
(4R)-4-[3-[[(2S)-3-amino-2-(tert-butylamino)propanoyl]amino]propylcarbamoyl]-6,6-dimethylheptanoic acid;methane (PubChem CID 157218068) has the molecular formula C21H44N4O4 and a molecular weight of 416.61 g/mol. Its IUPAC name is (4R)-4-[3-[[(2S)-3-amino-2-(tert-butylamino)propanoyl]amino]propylcarbamoyl]-6,6-dimethylheptanoic acid;methane.
| Compound Name | (4R)-4-[3-[[(2S)-3-amino-2-(tert-butylamino)propanoyl]amino]propylcarbamoyl]-6,6-dimethylheptanoic acid;methane |
|---|---|
| PubChem CID | 157218068 |
| Molecular Formula | C21H44N4O4 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | (4R)-4-[3-[[(2S)-3-amino-2-(tert-butylamino)propanoyl]amino]propylcarbamoyl]-6,6-dimethylheptanoic acid;methane |
| SMILES | C.CC(C)(C)C[C@@H](CCC(=O)O)C(=O)NCCCNC(=O)[C@H](CN)NC(C)(C)C |
| InChI | InChI=1S/C20H40N4O4.CH4/c1-19(2,3)12-14(8-9-16(25)26)17(27)22-10-7-11-23-18(28)15(13-21)24-20(4,5)6;/h14-15,24H,7-13,21H2,1-6H3,(H,22,27)(H,23,28)(H,25,26);1H4/t14-,15+;/m1./s1 |
| InChIKey | ASQQHKNTXJKQBP-LIOBNPLQSA-N |
| XLogP | 1.88 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|