C15H33N3O — CID 107471013
2-(aminomethyl)-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide (PubChem CID 107471013) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107471013 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | 2-(aminomethyl)-N-[3-(diethylamino)propyl]-4,4-dimethylpentanamide |
| SMILES | CCN(CC)CCCNC(=O)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C15H33N3O/c1-6-18(7-2)10-8-9-17-14(19)13(12-16)11-15(3,4)5/h13H,6-12,16H2,1-5H3,(H,17,19) |
| InChIKey | NMGYPPRIPLRDJJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|