C16H35N3O — CID 107471993
2-(aminomethyl)-4,4-dimethyl-N-[4-[methyl(propan-2-yl)amino]butyl]pentanamide (PubChem CID 107471993) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is 2-(aminomethyl)-4,4-dimethyl-N-[4-[methyl(propan-2-yl)amino]butyl]pentanamide.
| Compound Name | 2-(aminomethyl)-4,4-dimethyl-N-[4-[methyl(propan-2-yl)amino]butyl]pentanamide |
|---|---|
| PubChem CID | 107471993 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | 2-(aminomethyl)-4,4-dimethyl-N-[4-[methyl(propan-2-yl)amino]butyl]pentanamide |
| SMILES | CC(C)N(C)CCCCNC(=O)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C16H35N3O/c1-13(2)19(6)10-8-7-9-18-15(20)14(12-17)11-16(3,4)5/h13-14H,7-12,17H2,1-6H3,(H,18,20) |
| InChIKey | LSOWVVLLFMQXGE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|