C20H40N2O4 — CID 160891226
(4R)-4-[[5-(tert-butylamino)-4-oxopentyl]carbamoyl]-6,6-dimethylheptanoic acid;methane (PubChem CID 160891226) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is (4R)-4-[[5-(tert-butylamino)-4-oxopentyl]carbamoyl]-6,6-dimethylheptanoic acid;methane.
| Compound Name | (4R)-4-[[5-(tert-butylamino)-4-oxopentyl]carbamoyl]-6,6-dimethylheptanoic acid;methane |
|---|---|
| PubChem CID | 160891226 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (4R)-4-[[5-(tert-butylamino)-4-oxopentyl]carbamoyl]-6,6-dimethylheptanoic acid;methane |
| SMILES | C.CC(C)(C)C[C@@H](CCC(=O)O)C(=O)NCCCC(=O)CNC(C)(C)C |
| InChI | InChI=1S/C19H36N2O4.CH4/c1-18(2,3)12-14(9-10-16(23)24)17(25)20-11-7-8-15(22)13-21-19(4,5)6;/h14,21H,7-13H2,1-6H3,(H,20,25)(H,23,24);1H4/t14-;/m1./s1 |
| InChIKey | SOHHYWTYHBTQSQ-PFEQFJNWSA-N |
| XLogP | 3.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|