C16H31NO3 — CID 167701005
(2R)-4,4-dimethyl-2-[3-(4-methylpentylamino)-3-oxopropyl]pentanoic acid (PubChem CID 167701005) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2-[3-(4-methylpentylamino)-3-oxopropyl]pentanoic acid.
| Compound Name | (2R)-4,4-dimethyl-2-[3-(4-methylpentylamino)-3-oxopropyl]pentanoic acid |
|---|---|
| PubChem CID | 167701005 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (2R)-4,4-dimethyl-2-[3-(4-methylpentylamino)-3-oxopropyl]pentanoic acid |
| SMILES | CC(C)CCCNC(=O)CC[C@H](CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H31NO3/c1-12(2)7-6-10-17-14(18)9-8-13(15(19)20)11-16(3,4)5/h12-13H,6-11H2,1-5H3,(H,17,18)(H,19,20)/t13-/m1/s1 |
| InChIKey | LADLZIRGPSGQCP-CYBMUJFWSA-N |
| XLogP | 3.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|