C10H20Cl2N4O6S2 — CID 127239953
2-[[(2R)-2-amino-3-[[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]acetic acid;dihydrochloride (PubChem CID 127239953) has the molecular formula C10H20Cl2N4O6S2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-[[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]acetic acid;dihydrochloride.
| Compound Name | 2-[[(2R)-2-amino-3-[[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 127239953 |
| Molecular Formula | C10H20Cl2N4O6S2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 2-[[(2R)-2-amino-3-[[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]propanoyl]amino]acetic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CSSC[C@H](N)C(=O)NCC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H18N4O6S2.2ClH/c11-5(9(19)13-1-7(15)16)3-21-22-4-6(12)10(20)14-2-8(17)18;;/h5-6H,1-4,11-12H2,(H,13,19)(H,14,20)(H,15,16)(H,17,18);2*1H/t5-,6-;;/m0../s1 |
| InChIKey | QANJEJOUEUMYGL-USPAICOZSA-N |
| XLogP | -1.73 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|