C5H10N2O3Se — CID 175250934
2-[(2-amino-3-selanylpropanoyl)amino]acetic acid (PubChem CID 175250934) has the molecular formula C5H10N2O3Se and a molecular weight of 225.11 g/mol. Its IUPAC name is 2-[(2-amino-3-selanylpropanoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-3-selanylpropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 175250934 |
| Molecular Formula | C5H10N2O3Se |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 2-[(2-amino-3-selanylpropanoyl)amino]acetic acid |
| SMILES | NC(C[SeH])C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H10N2O3Se/c6-3(2-11)5(10)7-1-4(8)9/h3,11H,1-2,6H2,(H,7,10)(H,8,9) |
| InChIKey | LMKCRKVSYYPQRC-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|