C7H11F3N2O5S — CID 122705193
2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 122705193) has the molecular formula C7H11F3N2O5S and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122705193 |
| Molecular Formula | C7H11F3N2O5S |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H](CS)C(=O)NCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H10N2O3S.C2HF3O2/c6-3(2-11)5(10)7-1-4(8)9;3-2(4,5)1(6)7/h3,11H,1-2,6H2,(H,7,10)(H,8,9);(H,6,7)/t3-;/m1./s1 |
| InChIKey | MXSFOYPUMNYFEW-AENDTGMFSA-N |
| XLogP | -0.92 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|