C12H21N5O6S — CID 18254533
2-[[4-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid (PubChem CID 18254533) has the molecular formula C12H21N5O6S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-[[4-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid.
| Compound Name | 2-[[4-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18254533 |
| Molecular Formula | C12H21N5O6S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[[4-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NC(CC(N)=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H21N5O6S/c1-5(16-11(22)6(13)4-24)10(21)17-7(2-8(14)18)12(23)15-3-9(19)20/h5-7,24H,2-4,13H2,1H3,(H2,14,18)(H,15,23)(H,16,22)(H,17,21)(H,19,20) |
| InChIKey | AVGCTEHHYCWHPO-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|