C15H26N6O8S — CID 176992724
2-[[4-amino-2-[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid (PubChem CID 176992724) has the molecular formula C15H26N6O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is 2-[[4-amino-2-[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid.
| Compound Name | 2-[[4-amino-2-[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 176992724 |
| Molecular Formula | C15H26N6O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[[4-amino-2-[2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]-4-oxobutanoyl]amino]acetic acid |
| SMILES | CC(NC(=O)C(CO)NC(=O)[C@@H](N)CS)C(=O)NC(CC(N)=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H26N6O8S/c1-6(19-15(29)9(4-22)21-13(27)7(16)5-30)12(26)20-8(2-10(17)23)14(28)18-3-11(24)25/h6-9,22,30H,2-5,16H2,1H3,(H2,17,23)(H,18,28)(H,19,29)(H,20,26)(H,21,27)(H,24,25)/t6?,7-,8?,9?/m0/s1 |
| InChIKey | ZUDAQAFVYTYDIP-GIDQEGPBSA-N |
| XLogP | -5.21 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|