C14H19N3O4S — CID 18220005
2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]acetic acid (PubChem CID 18220005) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18220005 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]acetic acid |
| SMILES | NC(CS)C(=O)NC(Cc1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H19N3O4S/c15-10(8-22)13(20)17-11(14(21)16-7-12(18)19)6-9-4-2-1-3-5-9/h1-5,10-11,22H,6-8,15H2,(H,16,21)(H,17,20)(H,18,19) |
| InChIKey | HEPLXMBVMCXTBP-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|