C19H28N4O5S — CID 18262333
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]acetic acid (PubChem CID 18262333) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18262333 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]acetic acid |
| SMILES | CC(C)C(NC(=O)C(N)CS)C(=O)NC(Cc1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C19H28N4O5S/c1-11(2)16(23-17(26)13(20)10-29)19(28)22-14(18(27)21-9-15(24)25)8-12-6-4-3-5-7-12/h3-7,11,13-14,16,29H,8-10,20H2,1-2H3,(H,21,27)(H,22,28)(H,23,26)(H,24,25) |
| InChIKey | MIZHCRDXILWGPL-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|