C10H17NO2S2 — CID 139436846
1-tert-butyl-3-(methylsulfanylmethylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 139436846) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-tert-butyl-3-(methylsulfanylmethylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | 1-tert-butyl-3-(methylsulfanylmethylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139436846 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1-tert-butyl-3-(methylsulfanylmethylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | CSCSC1CC(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C10H17NO2S2/c1-10(2,3)11-8(12)5-7(9(11)13)15-6-14-4/h7H,5-6H2,1-4H3 |
| InChIKey | DFCUNEZTRKSGEB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|